C12H15F3N4O — CID 62402287
N-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 62402287) has the molecular formula C12H15F3N4O and a molecular weight of 288.27 g/mol. Its IUPAC name is N-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | N-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 62402287 |
| Molecular Formula | C12H15F3N4O |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | N-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | Cc1cc2ncc(CNCCOCC(F)(F)F)cn2n1 |
| InChI | InChI=1S/C12H15F3N4O/c1-9-4-11-17-6-10(7-19(11)18-9)5-16-2-3-20-8-12(13,14)15/h4,6-7,16H,2-3,5,8H2,1H3 |
| InChIKey | IQEDGVSEYGKGID-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|