About [(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]thiourea
[(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]thiourea (PubChem CID 6240316) has the molecular formula C11H9N5O4S3
and a molecular weight of 371.43 g/mol. Its IUPAC name is [(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]thiourea.
Molecular Properties
| Compound Name | [(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]thiourea |
| PubChem CID | 6240316 |
| Molecular Formula | C11H9N5O4S3 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | [(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]thiourea |
| SMILES | C/C(=N\NC(N)=S)c1ccc(-c2sc([N+](=O)[O-])cc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C11H9N5O4S3/c1-5(13-14-11(12)21)7-2-3-8(22-7)10-6(15(17)18)4-9(23-10)16(19)20/h2-4H,1H3,(H3,12,14,21)/b13-5+ |
| InChIKey | GYMOKPFVSSBOTM-WLRTZDKTSA-N |
| XLogP | 2.85 |
| TPSA | 136.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]thiourea?
The IUPAC name of [(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]thiourea (CID 6240316) is [(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]thiourea.
What is the SMILES notation for [(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]thiourea?
The canonical SMILES for [(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]thiourea is C/C(=N\NC(N)=S)c1ccc(-c2sc([N+](=O)[O-])cc2[N+](=O)[O-])s1.
What is the InChIKey of [(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]thiourea?
The InChIKey is GYMOKPFVSSBOTM-WLRTZDKTSA-N. The full InChI is InChI=1S/C11H9N5O4S3/c1-5(13-14-11(12)21)7-2-3-8(22-7)10-6(15(17)18)4-9(23-10)16(19)20/h2-4H,1H3,(H3,12,14,21)/b13-5+.
What are the key properties of [(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]thiourea?
[(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]thiourea has a molecular weight of 371.43 g/mol, XLogP of 2.85, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-[5-(3,5-dinitrothiophen-2-yl)thiophen-2-yl]ethylideneamino]thiourea is sourced from PubChem (CID 6240316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).