About 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-(methylamino)propanenitrile
3-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-(methylamino)propanenitrile (PubChem CID 62403772) has the molecular formula C9H14N4S
and a molecular weight of 210.31 g/mol. Its IUPAC name is 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-(methylamino)propanenitrile.
Molecular Properties
| Compound Name | 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-(methylamino)propanenitrile |
| PubChem CID | 62403772 |
| Molecular Formula | C9H14N4S |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-(methylamino)propanenitrile |
| SMILES | CNC(C#N)CSc1cc(C)nn1C |
| InChI | InChI=1S/C9H14N4S/c1-7-4-9(13(3)12-7)14-6-8(5-10)11-2/h4,8,11H,6H2,1-3H3 |
| InChIKey | XRMXMNWTXJBSCE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-(methylamino)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-(methylamino)propanenitrile?
The IUPAC name of 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-(methylamino)propanenitrile (CID 62403772) is 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-(methylamino)propanenitrile.
What is the SMILES notation for 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-(methylamino)propanenitrile?
The canonical SMILES for 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-(methylamino)propanenitrile is CNC(C#N)CSc1cc(C)nn1C.
What is the InChIKey of 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-(methylamino)propanenitrile?
The InChIKey is XRMXMNWTXJBSCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4S/c1-7-4-9(13(3)12-7)14-6-8(5-10)11-2/h4,8,11H,6H2,1-3H3.
What are the key properties of 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-(methylamino)propanenitrile?
3-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-(methylamino)propanenitrile has a molecular weight of 210.31 g/mol, XLogP of 0.93, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dimethylpyrazol-3-yl)sulfanyl-2-(methylamino)propanenitrile is sourced from PubChem (CID 62403772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).