C12H9FN2O3S — CID 62404177
2-[1-(4-fluorophenyl)-4-oxopyrimidin-2-yl]sulfanylacetic acid (PubChem CID 62404177) has the molecular formula C12H9FN2O3S and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)-4-oxopyrimidin-2-yl]sulfanylacetic acid.
| Compound Name | 2-[1-(4-fluorophenyl)-4-oxopyrimidin-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 62404177 |
| Molecular Formula | C12H9FN2O3S |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-[1-(4-fluorophenyl)-4-oxopyrimidin-2-yl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1nc(=O)ccn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C12H9FN2O3S/c13-8-1-3-9(4-2-8)15-6-5-10(16)14-12(15)19-7-11(17)18/h1-6H,7H2,(H,17,18) |
| InChIKey | HTKDGNQVDVEDPD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |