About 4-chloro-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]aniline
4-chloro-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]aniline (PubChem CID 62404398) has the molecular formula C15H15ClN4
and a molecular weight of 286.77 g/mol. Its IUPAC name is 4-chloro-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]aniline.
Molecular Properties
| Compound Name | 4-chloro-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]aniline |
| PubChem CID | 62404398 |
| Molecular Formula | C15H15ClN4 |
| Molecular Weight | 286.77 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 4-chloro-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]aniline |
| SMILES | Cc1nn(C)c2ncc(CNc3ccc(Cl)cc3)cc12 |
| InChI | InChI=1S/C15H15ClN4/c1-10-14-7-11(9-18-15(14)20(2)19-10)8-17-13-5-3-12(16)4-6-13/h3-7,9,17H,8H2,1-2H3 |
| InChIKey | FQAKHHLULVZGJA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.77 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]aniline?
The IUPAC name of 4-chloro-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]aniline (CID 62404398) is 4-chloro-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]aniline.
What is the SMILES notation for 4-chloro-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]aniline?
The canonical SMILES for 4-chloro-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]aniline is Cc1nn(C)c2ncc(CNc3ccc(Cl)cc3)cc12.
What is the InChIKey of 4-chloro-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]aniline?
The InChIKey is FQAKHHLULVZGJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClN4/c1-10-14-7-11(9-18-15(14)20(2)19-10)8-17-13-5-3-12(16)4-6-13/h3-7,9,17H,8H2,1-2H3.
What are the key properties of 4-chloro-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]aniline?
4-chloro-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]aniline has a molecular weight of 286.77 g/mol, XLogP of 3.54, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methyl]aniline is sourced from PubChem (CID 62404398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).