About 3-[5-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-2-fluorophenyl]prop-2-yn-1-ol
3-[5-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-2-fluorophenyl]prop-2-yn-1-ol (PubChem CID 62405006) has the molecular formula C15H15FN2OS
and a molecular weight of 290.36 g/mol. Its IUPAC name is 3-[5-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-2-fluorophenyl]prop-2-yn-1-ol.
Molecular Properties
| Compound Name | 3-[5-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-2-fluorophenyl]prop-2-yn-1-ol |
| PubChem CID | 62405006 |
| Molecular Formula | C15H15FN2OS |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 3-[5-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-2-fluorophenyl]prop-2-yn-1-ol |
| SMILES | Cc1cc(SCc2ccc(F)c(C#CCO)c2)n(C)n1 |
| InChI | InChI=1S/C15H15FN2OS/c1-11-8-15(18(2)17-11)20-10-12-5-6-14(16)13(9-12)4-3-7-19/h5-6,8-9,19H,7,10H2,1-2H3 |
| InChIKey | PEVNFHQBEAEZCY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-2-fluorophenyl]prop-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-2-fluorophenyl]prop-2-yn-1-ol?
The IUPAC name of 3-[5-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-2-fluorophenyl]prop-2-yn-1-ol (CID 62405006) is 3-[5-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-2-fluorophenyl]prop-2-yn-1-ol.
What is the SMILES notation for 3-[5-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-2-fluorophenyl]prop-2-yn-1-ol?
The canonical SMILES for 3-[5-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-2-fluorophenyl]prop-2-yn-1-ol is Cc1cc(SCc2ccc(F)c(C#CCO)c2)n(C)n1.
What is the InChIKey of 3-[5-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-2-fluorophenyl]prop-2-yn-1-ol?
The InChIKey is PEVNFHQBEAEZCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15FN2OS/c1-11-8-15(18(2)17-11)20-10-12-5-6-14(16)13(9-12)4-3-7-19/h5-6,8-9,19H,7,10H2,1-2H3.
What are the key properties of 3-[5-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-2-fluorophenyl]prop-2-yn-1-ol?
3-[5-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-2-fluorophenyl]prop-2-yn-1-ol has a molecular weight of 290.36 g/mol, XLogP of 2.50, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]-2-fluorophenyl]prop-2-yn-1-ol is sourced from PubChem (CID 62405006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).