C15H23N5O — CID 62405672
N-butan-2-yl-3-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]propanamide (PubChem CID 62405672) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is N-butan-2-yl-3-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]propanamide.
| Compound Name | N-butan-2-yl-3-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 62405672 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | N-butan-2-yl-3-[(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)methylamino]propanamide |
| SMILES | CCC(C)NC(=O)CCNCc1cnc2cc(C)nn2c1 |
| InChI | InChI=1S/C15H23N5O/c1-4-11(2)18-15(21)5-6-16-8-13-9-17-14-7-12(3)19-20(14)10-13/h7,9-11,16H,4-6,8H2,1-3H3,(H,18,21) |
| InChIKey | SYWSWUGUVAZAGF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|