C13H22N2O — CID 62405925
1-cyclohexyl-N-(1,2-oxazol-4-ylmethyl)propan-1-amine (PubChem CID 62405925) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-cyclohexyl-N-(1,2-oxazol-4-ylmethyl)propan-1-amine.
| Compound Name | 1-cyclohexyl-N-(1,2-oxazol-4-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 62405925 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-cyclohexyl-N-(1,2-oxazol-4-ylmethyl)propan-1-amine |
| SMILES | CCC(NCc1cnoc1)C1CCCCC1 |
| InChI | InChI=1S/C13H22N2O/c1-2-13(12-6-4-3-5-7-12)14-8-11-9-15-16-10-11/h9-10,12-14H,2-8H2,1H3 |
| InChIKey | LABAKRZFTOYJKD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |