About N-(cyanomethyl)-N'-(1-cyclohexylpropyl)oxamide
N-(cyanomethyl)-N'-(1-cyclohexylpropyl)oxamide (PubChem CID 62406161) has the molecular formula C13H21N3O2
and a molecular weight of 251.33 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-(1-cyclohexylpropyl)oxamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-N'-(1-cyclohexylpropyl)oxamide |
| PubChem CID | 62406161 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | N-(cyanomethyl)-N'-(1-cyclohexylpropyl)oxamide |
| SMILES | CCC(NC(=O)C(=O)NCC#N)C1CCCCC1 |
| InChI | InChI=1S/C13H21N3O2/c1-2-11(10-6-4-3-5-7-10)16-13(18)12(17)15-9-8-14/h10-11H,2-7,9H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | LZBYVSFFLUWNPB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-N'-(1-cyclohexylpropyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-N'-(1-cyclohexylpropyl)oxamide?
The IUPAC name of N-(cyanomethyl)-N'-(1-cyclohexylpropyl)oxamide (CID 62406161) is N-(cyanomethyl)-N'-(1-cyclohexylpropyl)oxamide.
What is the SMILES notation for N-(cyanomethyl)-N'-(1-cyclohexylpropyl)oxamide?
The canonical SMILES for N-(cyanomethyl)-N'-(1-cyclohexylpropyl)oxamide is CCC(NC(=O)C(=O)NCC#N)C1CCCCC1.
What is the InChIKey of N-(cyanomethyl)-N'-(1-cyclohexylpropyl)oxamide?
The InChIKey is LZBYVSFFLUWNPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O2/c1-2-11(10-6-4-3-5-7-10)16-13(18)12(17)15-9-8-14/h10-11H,2-7,9H2,1H3,(H,15,17)(H,16,18).
What are the key properties of N-(cyanomethyl)-N'-(1-cyclohexylpropyl)oxamide?
N-(cyanomethyl)-N'-(1-cyclohexylpropyl)oxamide has a molecular weight of 251.33 g/mol, XLogP of 1.10, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-N'-(1-cyclohexylpropyl)oxamide is sourced from PubChem (CID 62406161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).