C15H30N2O — CID 62407749
3-(tert-butylamino)-N-(1-cyclohexylethyl)propanamide (PubChem CID 62407749) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 3-(tert-butylamino)-N-(1-cyclohexylethyl)propanamide.
| Compound Name | 3-(tert-butylamino)-N-(1-cyclohexylethyl)propanamide |
|---|---|
| PubChem CID | 62407749 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 3-(tert-butylamino)-N-(1-cyclohexylethyl)propanamide |
| SMILES | CC(NC(=O)CCNC(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C15H30N2O/c1-12(13-8-6-5-7-9-13)17-14(18)10-11-16-15(2,3)4/h12-13,16H,5-11H2,1-4H3,(H,17,18) |
| InChIKey | MPZPKSQTWZGECZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |