C13H15FN4OS — CID 62409558
N-(5-amino-2-fluorophenyl)-2-(2,5-dimethylpyrazol-3-yl)sulfanylacetamide (PubChem CID 62409558) has the molecular formula C13H15FN4OS and a molecular weight of 294.36 g/mol. Its IUPAC name is N-(5-amino-2-fluorophenyl)-2-(2,5-dimethylpyrazol-3-yl)sulfanylacetamide.
| Compound Name | N-(5-amino-2-fluorophenyl)-2-(2,5-dimethylpyrazol-3-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 62409558 |
| Molecular Formula | C13H15FN4OS |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N-(5-amino-2-fluorophenyl)-2-(2,5-dimethylpyrazol-3-yl)sulfanylacetamide |
| SMILES | Cc1cc(SCC(=O)Nc2cc(N)ccc2F)n(C)n1 |
| InChI | InChI=1S/C13H15FN4OS/c1-8-5-13(18(2)17-8)20-7-12(19)16-11-6-9(15)3-4-10(11)14/h3-6H,7,15H2,1-2H3,(H,16,19) |
| InChIKey | DKNBNEVFQQCXOE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|