C16H8Cl10 — CID 624097
1-[1,1,2,2-tetrachloro-2-[4-(trichloromethyl)phenyl]ethyl]-4-(trichloromethyl)benzene (PubChem CID 624097) has the molecular formula C16H8Cl10 and a molecular weight of 554.77 g/mol. Its IUPAC name is 1-[1,1,2,2-tetrachloro-2-[4-(trichloromethyl)phenyl]ethyl]-4-(trichloromethyl)benzene.
| Compound Name | 1-[1,1,2,2-tetrachloro-2-[4-(trichloromethyl)phenyl]ethyl]-4-(trichloromethyl)benzene |
|---|---|
| PubChem CID | 624097 |
| Molecular Formula | C16H8Cl10 |
| Molecular Weight | 554.77 g/mol |
| Exact Mass | 549.75 |
| IUPAC Name | 1-[1,1,2,2-tetrachloro-2-[4-(trichloromethyl)phenyl]ethyl]-4-(trichloromethyl)benzene |
| SMILES | ClC(Cl)(Cl)c1ccc(C(Cl)(Cl)C(Cl)(Cl)c2ccc(C(Cl)(Cl)Cl)cc2)cc1 |
| InChI | InChI=1S/C16H8Cl10/c17-13(18,9-1-5-11(6-2-9)15(21,22)23)14(19,20)10-3-7-12(8-4-10)16(24,25)26/h1-8H |
| InChIKey | IWYVKFUNCZVSMI-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.77 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|