C12H10F3N3O2S — CID 62409710
2-[5-methyl-2-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-3-yl]sulfanylacetic acid (PubChem CID 62409710) has the molecular formula C12H10F3N3O2S and a molecular weight of 317.29 g/mol. Its IUPAC name is 2-[5-methyl-2-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-3-yl]sulfanylacetic acid.
| Compound Name | 2-[5-methyl-2-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-3-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 62409710 |
| Molecular Formula | C12H10F3N3O2S |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-[5-methyl-2-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-3-yl]sulfanylacetic acid |
| SMILES | Cc1cc(SCC(=O)O)n(-c2ccc(C(F)(F)F)cn2)n1 |
| InChI | InChI=1S/C12H10F3N3O2S/c1-7-4-10(21-6-11(19)20)18(17-7)9-3-2-8(5-16-9)12(13,14)15/h2-5H,6H2,1H3,(H,19,20) |
| InChIKey | MZCSPHRJABCOQG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |