C18H25ClO — CID 624098
4-chloro-1,8,9,11,11-pentamethyltricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-ol (PubChem CID 624098) has the molecular formula C18H25ClO and a molecular weight of 292.85 g/mol. Its IUPAC name is 4-chloro-1,8,9,11,11-pentamethyltricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-ol.
| Compound Name | 4-chloro-1,8,9,11,11-pentamethyltricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-ol |
|---|---|
| PubChem CID | 624098 |
| Molecular Formula | C18H25ClO |
| Molecular Weight | 292.85 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 4-chloro-1,8,9,11,11-pentamethyltricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-ol |
| SMILES | CC1(C)CC2(C)CC(C)(C1)C(C)(O)c1ccc(Cl)cc12 |
| InChI | InChI=1S/C18H25ClO/c1-15(2)9-16(3)11-17(4,10-15)18(5,20)13-7-6-12(19)8-14(13)16/h6-8,20H,9-11H2,1-5H3 |
| InChIKey | KIXLGLPDAVCLKF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.85 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |