C13H13ClN2O3S — CID 62410089
2-[1-(2-chlorophenyl)-3-(methoxymethyl)pyrazol-5-yl]sulfanylacetic acid (PubChem CID 62410089) has the molecular formula C13H13ClN2O3S and a molecular weight of 312.78 g/mol. Its IUPAC name is 2-[1-(2-chlorophenyl)-3-(methoxymethyl)pyrazol-5-yl]sulfanylacetic acid.
| Compound Name | 2-[1-(2-chlorophenyl)-3-(methoxymethyl)pyrazol-5-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 62410089 |
| Molecular Formula | C13H13ClN2O3S |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 2-[1-(2-chlorophenyl)-3-(methoxymethyl)pyrazol-5-yl]sulfanylacetic acid |
| SMILES | COCc1cc(SCC(=O)O)n(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C13H13ClN2O3S/c1-19-7-9-6-12(20-8-13(17)18)16(15-9)11-5-3-2-4-10(11)14/h2-6H,7-8H2,1H3,(H,17,18) |
| InChIKey | FMEGBWKMSOQKFJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |