C15H32N2 — CID 62412165
3-N-(cyclopropylmethyl)-1-N-(2-methylpropyl)-3-N-propan-2-ylbutane-1,3-diamine (PubChem CID 62412165) has the molecular formula C15H32N2 and a molecular weight of 240.43 g/mol. Its IUPAC name is 3-N-(cyclopropylmethyl)-1-N-(2-methylpropyl)-3-N-propan-2-ylbutane-1,3-diamine.
| Compound Name | 3-N-(cyclopropylmethyl)-1-N-(2-methylpropyl)-3-N-propan-2-ylbutane-1,3-diamine |
|---|---|
| PubChem CID | 62412165 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | 3-N-(cyclopropylmethyl)-1-N-(2-methylpropyl)-3-N-propan-2-ylbutane-1,3-diamine |
| SMILES | CC(C)CNCCC(C)N(CC1CC1)C(C)C |
| InChI | InChI=1S/C15H32N2/c1-12(2)10-16-9-8-14(5)17(13(3)4)11-15-6-7-15/h12-16H,6-11H2,1-5H3 |
| InChIKey | RQZXDWYYLCZCBP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|