About 3-bromo-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide
3-bromo-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide (PubChem CID 62415054) has the molecular formula C8H5BrN2O2S
and a molecular weight of 273.11 g/mol. Its IUPAC name is 3-bromo-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide.
Molecular Properties
| Compound Name | 3-bromo-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide |
| PubChem CID | 62415054 |
| Molecular Formula | C8H5BrN2O2S |
| Molecular Weight | 273.11 g/mol |
| Exact Mass | 271.93 |
| IUPAC Name | 3-bromo-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1cnoc1)c1sccc1Br |
| InChI | InChI=1S/C8H5BrN2O2S/c9-6-1-2-14-7(6)8(12)11-5-3-10-13-4-5/h1-4H,(H,11,12) |
| InChIKey | ZUQHWGODBJWVSH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.11 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide?
The IUPAC name of 3-bromo-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide (CID 62415054) is 3-bromo-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide.
What is the SMILES notation for 3-bromo-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide?
The canonical SMILES for 3-bromo-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide is O=C(Nc1cnoc1)c1sccc1Br.
What is the InChIKey of 3-bromo-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide?
The InChIKey is ZUQHWGODBJWVSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrN2O2S/c9-6-1-2-14-7(6)8(12)11-5-3-10-13-4-5/h1-4H,(H,11,12).
What are the key properties of 3-bromo-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide?
3-bromo-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide has a molecular weight of 273.11 g/mol, XLogP of 2.75, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-(1,2-oxazol-4-yl)thiophene-2-carboxamide is sourced from PubChem (CID 62415054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).