C6H8N2O3 — CID 62415061
2-methoxy-N-(1,2-oxazol-4-yl)acetamide (PubChem CID 62415061) has the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. Its IUPAC name is 2-methoxy-N-(1,2-oxazol-4-yl)acetamide.
| Compound Name | 2-methoxy-N-(1,2-oxazol-4-yl)acetamide |
|---|---|
| PubChem CID | 62415061 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 2-methoxy-N-(1,2-oxazol-4-yl)acetamide |
| SMILES | COCC(=O)Nc1cnoc1 |
| InChI | InChI=1S/C6H8N2O3/c1-10-4-6(9)8-5-2-7-11-3-5/h2-3H,4H2,1H3,(H,8,9) |
| InChIKey | KKLVTAURIJERQI-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |