C13H16N4 — CID 62416311
N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]cyclobutanamine (PubChem CID 62416311) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]cyclobutanamine.
| Compound Name | N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]cyclobutanamine |
|---|---|
| PubChem CID | 62416311 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]cyclobutanamine |
| SMILES | c1cncc(-c2[nH]ncc2CNC2CCC2)c1 |
| InChI | InChI=1S/C13H16N4/c1-4-12(5-1)15-8-11-9-16-17-13(11)10-3-2-6-14-7-10/h2-3,6-7,9,12,15H,1,4-5,8H2,(H,16,17) |
| InChIKey | TYHGICUJBVKOQD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |