C14H18BrNO2 — CID 62416412
N-(2-bromo-5-methoxyphenyl)-2-cyclopentylacetamide (PubChem CID 62416412) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is N-(2-bromo-5-methoxyphenyl)-2-cyclopentylacetamide.
| Compound Name | N-(2-bromo-5-methoxyphenyl)-2-cyclopentylacetamide |
|---|---|
| PubChem CID | 62416412 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | N-(2-bromo-5-methoxyphenyl)-2-cyclopentylacetamide |
| SMILES | COc1ccc(Br)c(NC(=O)CC2CCCC2)c1 |
| InChI | InChI=1S/C14H18BrNO2/c1-18-11-6-7-12(15)13(9-11)16-14(17)8-10-4-2-3-5-10/h6-7,9-10H,2-5,8H2,1H3,(H,16,17) |
| InChIKey | QTBDRDPGDYYLSJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |