C13H22N2 — CID 62417230
N-[[2-[[ethyl(methyl)amino]methyl]phenyl]methyl]ethanamine (PubChem CID 62417230) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N-[[2-[[ethyl(methyl)amino]methyl]phenyl]methyl]ethanamine.
| Compound Name | N-[[2-[[ethyl(methyl)amino]methyl]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 62417230 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N-[[2-[[ethyl(methyl)amino]methyl]phenyl]methyl]ethanamine |
| SMILES | CCNCc1ccccc1CN(C)CC |
| InChI | InChI=1S/C13H22N2/c1-4-14-10-12-8-6-7-9-13(12)11-15(3)5-2/h6-9,14H,4-5,10-11H2,1-3H3 |
| InChIKey | TTZMJRBXVITHRS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |