C17H30N2 — CID 62417355
N-[[3-[(tert-butylamino)methyl]phenyl]methyl]-N-methylbutan-2-amine (PubChem CID 62417355) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is N-[[3-[(tert-butylamino)methyl]phenyl]methyl]-N-methylbutan-2-amine.
| Compound Name | N-[[3-[(tert-butylamino)methyl]phenyl]methyl]-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 62417355 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | N-[[3-[(tert-butylamino)methyl]phenyl]methyl]-N-methylbutan-2-amine |
| SMILES | CCC(C)N(C)Cc1cccc(CNC(C)(C)C)c1 |
| InChI | InChI=1S/C17H30N2/c1-7-14(2)19(6)13-16-10-8-9-15(11-16)12-18-17(3,4)5/h8-11,14,18H,7,12-13H2,1-6H3 |
| InChIKey | LEMKUIKWOVOREU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |