C12H20N2OS — CID 62418078
N-methyl-1-[2-methyl-5-(thiomorpholin-4-ylmethyl)furan-3-yl]methanamine (PubChem CID 62418078) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is N-methyl-1-[2-methyl-5-(thiomorpholin-4-ylmethyl)furan-3-yl]methanamine.
| Compound Name | N-methyl-1-[2-methyl-5-(thiomorpholin-4-ylmethyl)furan-3-yl]methanamine |
|---|---|
| PubChem CID | 62418078 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N-methyl-1-[2-methyl-5-(thiomorpholin-4-ylmethyl)furan-3-yl]methanamine |
| SMILES | CNCc1cc(CN2CCSCC2)oc1C |
| InChI | InChI=1S/C12H20N2OS/c1-10-11(8-13-2)7-12(15-10)9-14-3-5-16-6-4-14/h7,13H,3-6,8-9H2,1-2H3 |
| InChIKey | UXLXJVCPXLGVGA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |