C10H22N2 — CID 62418784
1-N-cyclopropyl-4-N,4-N-dimethylpentane-1,4-diamine (PubChem CID 62418784) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is 1-N-cyclopropyl-4-N,4-N-dimethylpentane-1,4-diamine.
| Compound Name | 1-N-cyclopropyl-4-N,4-N-dimethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 62418784 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 1-N-cyclopropyl-4-N,4-N-dimethylpentane-1,4-diamine |
| SMILES | CC(CCCNC1CC1)N(C)C |
| InChI | InChI=1S/C10H22N2/c1-9(12(2)3)5-4-8-11-10-6-7-10/h9-11H,4-8H2,1-3H3 |
| InChIKey | PBUQERLYPHPXKX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|