C11H20N2O — CID 62419080
N-[[3-(aminomethyl)furan-2-yl]methyl]-N-methylbutan-2-amine (PubChem CID 62419080) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is N-[[3-(aminomethyl)furan-2-yl]methyl]-N-methylbutan-2-amine.
| Compound Name | N-[[3-(aminomethyl)furan-2-yl]methyl]-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 62419080 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | N-[[3-(aminomethyl)furan-2-yl]methyl]-N-methylbutan-2-amine |
| SMILES | CCC(C)N(C)Cc1occc1CN |
| InChI | InChI=1S/C11H20N2O/c1-4-9(2)13(3)8-11-10(7-12)5-6-14-11/h5-6,9H,4,7-8,12H2,1-3H3 |
| InChIKey | LQANGQWGPPLQAD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |