C16H26ClN3 — CID 62419647
3-[4-(2-chlorophenyl)piperazin-1-yl]-N-ethyl-2-methylpropan-1-amine (PubChem CID 62419647) has the molecular formula C16H26ClN3 and a molecular weight of 295.86 g/mol. Its IUPAC name is 3-[4-(2-chlorophenyl)piperazin-1-yl]-N-ethyl-2-methylpropan-1-amine.
| Compound Name | 3-[4-(2-chlorophenyl)piperazin-1-yl]-N-ethyl-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 62419647 |
| Molecular Formula | C16H26ClN3 |
| Molecular Weight | 295.86 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 3-[4-(2-chlorophenyl)piperazin-1-yl]-N-ethyl-2-methylpropan-1-amine |
| SMILES | CCNCC(C)CN1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C16H26ClN3/c1-3-18-12-14(2)13-19-8-10-20(11-9-19)16-7-5-4-6-15(16)17/h4-7,14,18H,3,8-13H2,1-2H3 |
| InChIKey | WMOGXJWFINXKLG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.86 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |