About 2-N-cyclopropyl-1-N,2-N-dimethylpropane-1,2-diamine
2-N-cyclopropyl-1-N,2-N-dimethylpropane-1,2-diamine (PubChem CID 62419681) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is 2-N-cyclopropyl-1-N,2-N-dimethylpropane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-cyclopropyl-1-N,2-N-dimethylpropane-1,2-diamine |
| PubChem CID | 62419681 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 2-N-cyclopropyl-1-N,2-N-dimethylpropane-1,2-diamine |
| SMILES | CNCC(C)N(C)C1CC1 |
| InChI | InChI=1S/C8H18N2/c1-7(6-9-2)10(3)8-4-5-8/h7-9H,4-6H2,1-3H3 |
| InChIKey | NLFIBUAARPTHDW-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-N-cyclopropyl-1-N,2-N-dimethylpropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-cyclopropyl-1-N,2-N-dimethylpropane-1,2-diamine?
The IUPAC name of 2-N-cyclopropyl-1-N,2-N-dimethylpropane-1,2-diamine (CID 62419681) is 2-N-cyclopropyl-1-N,2-N-dimethylpropane-1,2-diamine.
What is the SMILES notation for 2-N-cyclopropyl-1-N,2-N-dimethylpropane-1,2-diamine?
The canonical SMILES for 2-N-cyclopropyl-1-N,2-N-dimethylpropane-1,2-diamine is CNCC(C)N(C)C1CC1.
What is the InChIKey of 2-N-cyclopropyl-1-N,2-N-dimethylpropane-1,2-diamine?
The InChIKey is NLFIBUAARPTHDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2/c1-7(6-9-2)10(3)8-4-5-8/h7-9H,4-6H2,1-3H3.
What are the key properties of 2-N-cyclopropyl-1-N,2-N-dimethylpropane-1,2-diamine?
2-N-cyclopropyl-1-N,2-N-dimethylpropane-1,2-diamine has a molecular weight of 142.25 g/mol, XLogP of 0.69, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-cyclopropyl-1-N,2-N-dimethylpropane-1,2-diamine is sourced from PubChem (CID 62419681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).