C16H19NO7 — CID 624197
trimethyl 2-methyl-5-phenyl-1,2-oxazolidine-3,3,4-tricarboxylate (PubChem CID 624197) has the molecular formula C16H19NO7 and a molecular weight of 337.33 g/mol. Its IUPAC name is trimethyl 2-methyl-5-phenyl-1,2-oxazolidine-3,3,4-tricarboxylate.
| Compound Name | trimethyl 2-methyl-5-phenyl-1,2-oxazolidine-3,3,4-tricarboxylate |
|---|---|
| PubChem CID | 624197 |
| Molecular Formula | C16H19NO7 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | trimethyl 2-methyl-5-phenyl-1,2-oxazolidine-3,3,4-tricarboxylate |
| SMILES | COC(=O)C1C(c2ccccc2)ON(C)C1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C16H19NO7/c1-17-16(14(19)22-3,15(20)23-4)11(13(18)21-2)12(24-17)10-8-6-5-7-9-10/h5-9,11-12H,1-4H3 |
| InChIKey | LUQULPUJJPUYOV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|