C9H20N2O — CID 62419753
1-[5-[(dimethylamino)methyl]oxolan-2-yl]-N-methylmethanamine (PubChem CID 62419753) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is 1-[5-[(dimethylamino)methyl]oxolan-2-yl]-N-methylmethanamine.
| Compound Name | 1-[5-[(dimethylamino)methyl]oxolan-2-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 62419753 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 1-[5-[(dimethylamino)methyl]oxolan-2-yl]-N-methylmethanamine |
| SMILES | CNCC1CCC(CN(C)C)O1 |
| InChI | InChI=1S/C9H20N2O/c1-10-6-8-4-5-9(12-8)7-11(2)3/h8-10H,4-7H2,1-3H3 |
| InChIKey | UFDYWLCXPWXRGH-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |