C17H24N2S — CID 62420227
N-[[4-[[methyl(thiophen-2-ylmethyl)amino]methyl]phenyl]methyl]propan-1-amine (PubChem CID 62420227) has the molecular formula C17H24N2S and a molecular weight of 288.46 g/mol. Its IUPAC name is N-[[4-[[methyl(thiophen-2-ylmethyl)amino]methyl]phenyl]methyl]propan-1-amine.
| Compound Name | N-[[4-[[methyl(thiophen-2-ylmethyl)amino]methyl]phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62420227 |
| Molecular Formula | C17H24N2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | N-[[4-[[methyl(thiophen-2-ylmethyl)amino]methyl]phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(CN(C)Cc2cccs2)cc1 |
| InChI | InChI=1S/C17H24N2S/c1-3-10-18-12-15-6-8-16(9-7-15)13-19(2)14-17-5-4-11-20-17/h4-9,11,18H,3,10,12-14H2,1-2H3 |
| InChIKey | FDUPZHFVXYIIMZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|