methyl 3,5-dibromo-2-hydroxybenzoate

C8H6Br2O3 — CID 624217

IUPACmethyl 3,5-dibromo-2-hydroxybenzoate
SMILESCOC(=O)c1cc(Br)cc(Br)c1O
InChIInChI=1S/C8H6Br2O3/c1-13-8(12)5-2-4(9)3-6(10)7(5)11/h2-3,11H,1H3
InChIKeyKISQISIKTRRMOX-UHFFFAOYSA-N
MW309.94 g/mol
LogP2.70
Rot. Bonds1

About methyl 3,5-dibromo-2-hydroxybenzoate

methyl 3,5-dibromo-2-hydroxybenzoate (PubChem CID 624217) has the molecular formula C8H6Br2O3 and a molecular weight of 309.94 g/mol. Its IUPAC name is methyl 3,5-dibromo-2-hydroxybenzoate.

Molecular Properties

Compound Namemethyl 3,5-dibromo-2-hydroxybenzoate
PubChem CID624217
Molecular FormulaC8H6Br2O3
Molecular Weight309.94 g/mol
Exact Mass307.87
IUPAC Namemethyl 3,5-dibromo-2-hydroxybenzoate
SMILESCOC(=O)c1cc(Br)cc(Br)c1O
InChIInChI=1S/C8H6Br2O3/c1-13-8(12)5-2-4(9)3-6(10)7(5)11/h2-3,11H,1H3
InChIKeyKISQISIKTRRMOX-UHFFFAOYSA-N
XLogP2.70
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500309.94
LogP ≤ 52.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 3,5-dibromo-2-hydroxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,5-dibromo-2-hydroxybenzoate?
The IUPAC name of methyl 3,5-dibromo-2-hydroxybenzoate (CID 624217) is methyl 3,5-dibromo-2-hydroxybenzoate.
What is the SMILES notation for methyl 3,5-dibromo-2-hydroxybenzoate?
The canonical SMILES for methyl 3,5-dibromo-2-hydroxybenzoate is COC(=O)c1cc(Br)cc(Br)c1O.
What is the InChIKey of methyl 3,5-dibromo-2-hydroxybenzoate?
The InChIKey is KISQISIKTRRMOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Br2O3/c1-13-8(12)5-2-4(9)3-6(10)7(5)11/h2-3,11H,1H3.
What are the key properties of methyl 3,5-dibromo-2-hydroxybenzoate?
methyl 3,5-dibromo-2-hydroxybenzoate has a molecular weight of 309.94 g/mol, XLogP of 2.70, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,5-dibromo-2-hydroxybenzoate is sourced from PubChem (CID 624217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).