C15H26N2 — CID 62422195
N-[[4-(methylaminomethyl)phenyl]methyl]-N-propan-2-ylpropan-1-amine (PubChem CID 62422195) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is N-[[4-(methylaminomethyl)phenyl]methyl]-N-propan-2-ylpropan-1-amine.
| Compound Name | N-[[4-(methylaminomethyl)phenyl]methyl]-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 62422195 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | N-[[4-(methylaminomethyl)phenyl]methyl]-N-propan-2-ylpropan-1-amine |
| SMILES | CCCN(Cc1ccc(CNC)cc1)C(C)C |
| InChI | InChI=1S/C15H26N2/c1-5-10-17(13(2)3)12-15-8-6-14(7-9-15)11-16-4/h6-9,13,16H,5,10-12H2,1-4H3 |
| InChIKey | FRJPRYCEXVDGBI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |