About 1-N,2-N-dimethyl-2-N-(thiolan-3-yl)butane-1,2-diamine
1-N,2-N-dimethyl-2-N-(thiolan-3-yl)butane-1,2-diamine (PubChem CID 62422780) has the molecular formula C10H22N2S
and a molecular weight of 202.37 g/mol. Its IUPAC name is 1-N,2-N-dimethyl-2-N-(thiolan-3-yl)butane-1,2-diamine.
Analyze 1-N,2-N-dimethyl-2-N-(thiolan-3-yl)butane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,2-N-dimethyl-2-N-(thiolan-3-yl)butane-1,2-diamine?
The IUPAC name of 1-N,2-N-dimethyl-2-N-(thiolan-3-yl)butane-1,2-diamine (CID 62422780) is 1-N,2-N-dimethyl-2-N-(thiolan-3-yl)butane-1,2-diamine.
What is the SMILES notation for 1-N,2-N-dimethyl-2-N-(thiolan-3-yl)butane-1,2-diamine?
The canonical SMILES for 1-N,2-N-dimethyl-2-N-(thiolan-3-yl)butane-1,2-diamine is CCC(CNC)N(C)C1CCSC1.
What is the InChIKey of 1-N,2-N-dimethyl-2-N-(thiolan-3-yl)butane-1,2-diamine?
The InChIKey is AWQHTAHIIFPDFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2S/c1-4-9(7-11-2)12(3)10-5-6-13-8-10/h9-11H,4-8H2,1-3H3.
What are the key properties of 1-N,2-N-dimethyl-2-N-(thiolan-3-yl)butane-1,2-diamine?
1-N,2-N-dimethyl-2-N-(thiolan-3-yl)butane-1,2-diamine has a molecular weight of 202.37 g/mol, XLogP of 1.42, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,2-N-dimethyl-2-N-(thiolan-3-yl)butane-1,2-diamine is sourced from PubChem (CID 62422780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).