About (2-aminophenyl)-(6,7-dimethoxyisoquinolin-1-yl)methanone
(2-aminophenyl)-(6,7-dimethoxyisoquinolin-1-yl)methanone (PubChem CID 624270) has the molecular formula C18H16N2O3
and a molecular weight of 308.34 g/mol. Its IUPAC name is (2-aminophenyl)-(6,7-dimethoxyisoquinolin-1-yl)methanone.
Molecular Properties
| Compound Name | (2-aminophenyl)-(6,7-dimethoxyisoquinolin-1-yl)methanone |
| PubChem CID | 624270 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (2-aminophenyl)-(6,7-dimethoxyisoquinolin-1-yl)methanone |
| SMILES | COc1cc2ccnc(C(=O)c3ccccc3N)c2cc1OC |
| InChI | InChI=1S/C18H16N2O3/c1-22-15-9-11-7-8-20-17(13(11)10-16(15)23-2)18(21)12-5-3-4-6-14(12)19/h3-10H,19H2,1-2H3 |
| InChIKey | LXAGKSTZYNDXEO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2-aminophenyl)-(6,7-dimethoxyisoquinolin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminophenyl)-(6,7-dimethoxyisoquinolin-1-yl)methanone?
The IUPAC name of (2-aminophenyl)-(6,7-dimethoxyisoquinolin-1-yl)methanone (CID 624270) is (2-aminophenyl)-(6,7-dimethoxyisoquinolin-1-yl)methanone.
What is the SMILES notation for (2-aminophenyl)-(6,7-dimethoxyisoquinolin-1-yl)methanone?
The canonical SMILES for (2-aminophenyl)-(6,7-dimethoxyisoquinolin-1-yl)methanone is COc1cc2ccnc(C(=O)c3ccccc3N)c2cc1OC.
What is the InChIKey of (2-aminophenyl)-(6,7-dimethoxyisoquinolin-1-yl)methanone?
The InChIKey is LXAGKSTZYNDXEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O3/c1-22-15-9-11-7-8-20-17(13(11)10-16(15)23-2)18(21)12-5-3-4-6-14(12)19/h3-10H,19H2,1-2H3.
What are the key properties of (2-aminophenyl)-(6,7-dimethoxyisoquinolin-1-yl)methanone?
(2-aminophenyl)-(6,7-dimethoxyisoquinolin-1-yl)methanone has a molecular weight of 308.34 g/mol, XLogP of 3.07, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminophenyl)-(6,7-dimethoxyisoquinolin-1-yl)methanone is sourced from PubChem (CID 624270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).