C17H32N2O — CID 62427206
N,3,3-trimethyl-N-[[2-methyl-5-(propylaminomethyl)furan-3-yl]methyl]butan-2-amine (PubChem CID 62427206) has the molecular formula C17H32N2O and a molecular weight of 280.46 g/mol. Its IUPAC name is N,3,3-trimethyl-N-[[2-methyl-5-(propylaminomethyl)furan-3-yl]methyl]butan-2-amine.
| Compound Name | N,3,3-trimethyl-N-[[2-methyl-5-(propylaminomethyl)furan-3-yl]methyl]butan-2-amine |
|---|---|
| PubChem CID | 62427206 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | N,3,3-trimethyl-N-[[2-methyl-5-(propylaminomethyl)furan-3-yl]methyl]butan-2-amine |
| SMILES | CCCNCc1cc(CN(C)C(C)C(C)(C)C)c(C)o1 |
| InChI | InChI=1S/C17H32N2O/c1-8-9-18-11-16-10-15(13(2)20-16)12-19(7)14(3)17(4,5)6/h10,14,18H,8-9,11-12H2,1-7H3 |
| InChIKey | CLLSNZVGEZSIJL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|