C11H23F3N2 — CID 62428580
N-(2-methylpropyl)-N'-propan-2-yl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine (PubChem CID 62428580) has the molecular formula C11H23F3N2 and a molecular weight of 240.31 g/mol. Its IUPAC name is N-(2-methylpropyl)-N'-propan-2-yl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine.
| Compound Name | N-(2-methylpropyl)-N'-propan-2-yl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62428580 |
| Molecular Formula | C11H23F3N2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | N-(2-methylpropyl)-N'-propan-2-yl-N'-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
| SMILES | CC(C)CNCCN(CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C11H23F3N2/c1-9(2)7-15-5-6-16(10(3)4)8-11(12,13)14/h9-10,15H,5-8H2,1-4H3 |
| InChIKey | VESCLCMKBPQHJW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|