C26H34O6 — CID 624302
(17-acetyl-17-acetyloxy-6,10,13-trimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-2-yl) acetate (PubChem CID 624302) has the molecular formula C26H34O6 and a molecular weight of 442.55 g/mol. Its IUPAC name is (17-acetyl-17-acetyloxy-6,10,13-trimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-2-yl) acetate.
| Compound Name | (17-acetyl-17-acetyloxy-6,10,13-trimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-2-yl) acetate |
|---|---|
| PubChem CID | 624302 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | (17-acetyl-17-acetyloxy-6,10,13-trimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-2-yl) acetate |
| SMILES | CC(=O)OC1CC2(C)C(=CC1=O)C(C)=CC1C2CCC2(C)C1CCC2(OC(C)=O)C(C)=O |
| InChI | InChI=1S/C26H34O6/c1-14-11-18-19(24(5)13-23(31-16(3)28)22(30)12-21(14)24)7-9-25(6)20(18)8-10-26(25,15(2)27)32-17(4)29/h11-12,18-20,23H,7-10,13H2,1-6H3 |
| InChIKey | TZOVWGISOSCIGE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |