C11H22N2OS — CID 62430618
N-[2-(1-oxo-1,4-thiazinan-4-yl)butyl]cyclopropanamine (PubChem CID 62430618) has the molecular formula C11H22N2OS and a molecular weight of 230.38 g/mol. Its IUPAC name is N-[2-(1-oxo-1,4-thiazinan-4-yl)butyl]cyclopropanamine.
| Compound Name | N-[2-(1-oxo-1,4-thiazinan-4-yl)butyl]cyclopropanamine |
|---|---|
| PubChem CID | 62430618 |
| Molecular Formula | C11H22N2OS |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | N-[2-(1-oxo-1,4-thiazinan-4-yl)butyl]cyclopropanamine |
| SMILES | CCC(CNC1CC1)N1CCS(=O)CC1 |
| InChI | InChI=1S/C11H22N2OS/c1-2-11(9-12-10-3-4-10)13-5-7-15(14)8-6-13/h10-12H,2-9H2,1H3 |
| InChIKey | WYIXIHPTMFUHJZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |