C17H28N2O2 — CID 62430750
2-methoxy-N-methyl-N-[[5-[(propan-2-ylamino)methyl]oxolan-2-yl]methyl]aniline (PubChem CID 62430750) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 2-methoxy-N-methyl-N-[[5-[(propan-2-ylamino)methyl]oxolan-2-yl]methyl]aniline.
| Compound Name | 2-methoxy-N-methyl-N-[[5-[(propan-2-ylamino)methyl]oxolan-2-yl]methyl]aniline |
|---|---|
| PubChem CID | 62430750 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 2-methoxy-N-methyl-N-[[5-[(propan-2-ylamino)methyl]oxolan-2-yl]methyl]aniline |
| SMILES | COc1ccccc1N(C)CC1CCC(CNC(C)C)O1 |
| InChI | InChI=1S/C17H28N2O2/c1-13(2)18-11-14-9-10-15(21-14)12-19(3)16-7-5-6-8-17(16)20-4/h5-8,13-15,18H,9-12H2,1-4H3 |
| InChIKey | QIMJCTXBWTZPDS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |