C16H25N5 — CID 62431050
N,4-dimethyl-N-[2-[4-[(propan-2-ylamino)methyl]triazol-1-yl]ethyl]aniline (PubChem CID 62431050) has the molecular formula C16H25N5 and a molecular weight of 287.41 g/mol. Its IUPAC name is N,4-dimethyl-N-[2-[4-[(propan-2-ylamino)methyl]triazol-1-yl]ethyl]aniline.
| Compound Name | N,4-dimethyl-N-[2-[4-[(propan-2-ylamino)methyl]triazol-1-yl]ethyl]aniline |
|---|---|
| PubChem CID | 62431050 |
| Molecular Formula | C16H25N5 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | N,4-dimethyl-N-[2-[4-[(propan-2-ylamino)methyl]triazol-1-yl]ethyl]aniline |
| SMILES | Cc1ccc(N(C)CCn2cc(CNC(C)C)nn2)cc1 |
| InChI | InChI=1S/C16H25N5/c1-13(2)17-11-15-12-21(19-18-15)10-9-20(4)16-7-5-14(3)6-8-16/h5-8,12-13,17H,9-11H2,1-4H3 |
| InChIKey | BHIHIQHALSGPNP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|