C16H28N2O2 — CID 62431851
N-methyl-N-[[2-methyl-5-[(propan-2-ylamino)methyl]furan-3-yl]methyl]oxan-4-amine (PubChem CID 62431851) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is N-methyl-N-[[2-methyl-5-[(propan-2-ylamino)methyl]furan-3-yl]methyl]oxan-4-amine.
| Compound Name | N-methyl-N-[[2-methyl-5-[(propan-2-ylamino)methyl]furan-3-yl]methyl]oxan-4-amine |
|---|---|
| PubChem CID | 62431851 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | N-methyl-N-[[2-methyl-5-[(propan-2-ylamino)methyl]furan-3-yl]methyl]oxan-4-amine |
| SMILES | Cc1oc(CNC(C)C)cc1CN(C)C1CCOCC1 |
| InChI | InChI=1S/C16H28N2O2/c1-12(2)17-10-16-9-14(13(3)20-16)11-18(4)15-5-7-19-8-6-15/h9,12,15,17H,5-8,10-11H2,1-4H3 |
| InChIKey | LEMQJYMKRPRPFB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |