About 2-(2,2-dimethylmorpholin-4-yl)-N,3-dimethylbutan-1-amine
2-(2,2-dimethylmorpholin-4-yl)-N,3-dimethylbutan-1-amine (PubChem CID 62432232) has the molecular formula C12H26N2O
and a molecular weight of 214.35 g/mol. Its IUPAC name is 2-(2,2-dimethylmorpholin-4-yl)-N,3-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 2-(2,2-dimethylmorpholin-4-yl)-N,3-dimethylbutan-1-amine |
| PubChem CID | 62432232 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 2-(2,2-dimethylmorpholin-4-yl)-N,3-dimethylbutan-1-amine |
| SMILES | CNCC(C(C)C)N1CCOC(C)(C)C1 |
| InChI | InChI=1S/C12H26N2O/c1-10(2)11(8-13-5)14-6-7-15-12(3,4)9-14/h10-11,13H,6-9H2,1-5H3 |
| InChIKey | NGUKVVXSUOFERJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,2-dimethylmorpholin-4-yl)-N,3-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylmorpholin-4-yl)-N,3-dimethylbutan-1-amine?
The IUPAC name of 2-(2,2-dimethylmorpholin-4-yl)-N,3-dimethylbutan-1-amine (CID 62432232) is 2-(2,2-dimethylmorpholin-4-yl)-N,3-dimethylbutan-1-amine.
What is the SMILES notation for 2-(2,2-dimethylmorpholin-4-yl)-N,3-dimethylbutan-1-amine?
The canonical SMILES for 2-(2,2-dimethylmorpholin-4-yl)-N,3-dimethylbutan-1-amine is CNCC(C(C)C)N1CCOC(C)(C)C1.
What is the InChIKey of 2-(2,2-dimethylmorpholin-4-yl)-N,3-dimethylbutan-1-amine?
The InChIKey is NGUKVVXSUOFERJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O/c1-10(2)11(8-13-5)14-6-7-15-12(3,4)9-14/h10-11,13H,6-9H2,1-5H3.
What are the key properties of 2-(2,2-dimethylmorpholin-4-yl)-N,3-dimethylbutan-1-amine?
2-(2,2-dimethylmorpholin-4-yl)-N,3-dimethylbutan-1-amine has a molecular weight of 214.35 g/mol, XLogP of 1.34, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylmorpholin-4-yl)-N,3-dimethylbutan-1-amine is sourced from PubChem (CID 62432232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).