About 4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(2-methylpropyl)pentan-1-amine
4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(2-methylpropyl)pentan-1-amine (PubChem CID 62433253) has the molecular formula C13H28N2O2S
and a molecular weight of 276.45 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(2-methylpropyl)pentan-1-amine.
Molecular Properties
| Compound Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(2-methylpropyl)pentan-1-amine |
| PubChem CID | 62433253 |
| Molecular Formula | C13H28N2O2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(2-methylpropyl)pentan-1-amine |
| SMILES | CC(C)CNCCCC(C)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H28N2O2S/c1-12(2)11-14-6-4-5-13(3)15-7-9-18(16,17)10-8-15/h12-14H,4-11H2,1-3H3 |
| InChIKey | ZGWQZHUAXSEUDJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(2-methylpropyl)pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(2-methylpropyl)pentan-1-amine?
The IUPAC name of 4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(2-methylpropyl)pentan-1-amine (CID 62433253) is 4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(2-methylpropyl)pentan-1-amine.
What is the SMILES notation for 4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(2-methylpropyl)pentan-1-amine?
The canonical SMILES for 4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(2-methylpropyl)pentan-1-amine is CC(C)CNCCCC(C)N1CCS(=O)(=O)CC1.
What is the InChIKey of 4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(2-methylpropyl)pentan-1-amine?
The InChIKey is ZGWQZHUAXSEUDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O2S/c1-12(2)11-14-6-4-5-13(3)15-7-9-18(16,17)10-8-15/h12-14H,4-11H2,1-3H3.
What are the key properties of 4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(2-methylpropyl)pentan-1-amine?
4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(2-methylpropyl)pentan-1-amine has a molecular weight of 276.45 g/mol, XLogP of 1.13, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-(2-methylpropyl)pentan-1-amine is sourced from PubChem (CID 62433253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).