C14H27N — CID 6243343
(2Z)-N,N-diethyl-3,7-dimethylocta-2,6-dien-1-amine (PubChem CID 6243343) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is (2Z)-N,N-diethyl-3,7-dimethylocta-2,6-dien-1-amine.
| Compound Name | (2Z)-N,N-diethyl-3,7-dimethylocta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 6243343 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | (2Z)-N,N-diethyl-3,7-dimethylocta-2,6-dien-1-amine |
| SMILES | CCN(CC)C/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C14H27N/c1-6-15(7-2)12-11-14(5)10-8-9-13(3)4/h9,11H,6-8,10,12H2,1-5H3/b14-11- |
| InChIKey | XDEJHXKVKISANH-KAMYIIQDSA-N |
| XLogP | 4.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|