C14H30N2O — CID 62433658
N-tert-butyl-2-(2,2-dimethylmorpholin-4-yl)butan-1-amine (PubChem CID 62433658) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is N-tert-butyl-2-(2,2-dimethylmorpholin-4-yl)butan-1-amine.
| Compound Name | N-tert-butyl-2-(2,2-dimethylmorpholin-4-yl)butan-1-amine |
|---|---|
| PubChem CID | 62433658 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | N-tert-butyl-2-(2,2-dimethylmorpholin-4-yl)butan-1-amine |
| SMILES | CCC(CNC(C)(C)C)N1CCOC(C)(C)C1 |
| InChI | InChI=1S/C14H30N2O/c1-7-12(10-15-13(2,3)4)16-8-9-17-14(5,6)11-16/h12,15H,7-11H2,1-6H3 |
| InChIKey | WVUAXDZUWJTYIO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |