C16H34N2 — CID 62433849
N-tert-butyl-N'-cycloheptyl-N'-methylbutane-1,4-diamine (PubChem CID 62433849) has the molecular formula C16H34N2 and a molecular weight of 254.46 g/mol. Its IUPAC name is N-tert-butyl-N'-cycloheptyl-N'-methylbutane-1,4-diamine.
| Compound Name | N-tert-butyl-N'-cycloheptyl-N'-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 62433849 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | N-tert-butyl-N'-cycloheptyl-N'-methylbutane-1,4-diamine |
| SMILES | CN(CCCCNC(C)(C)C)C1CCCCCC1 |
| InChI | InChI=1S/C16H34N2/c1-16(2,3)17-13-9-10-14-18(4)15-11-7-5-6-8-12-15/h15,17H,5-14H2,1-4H3 |
| InChIKey | PEPVISGELIKNND-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|