C16H28N2 — CID 62434751
N'-(4-ethylphenyl)-N'-methyl-N-propylbutane-1,4-diamine (PubChem CID 62434751) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is N'-(4-ethylphenyl)-N'-methyl-N-propylbutane-1,4-diamine.
| Compound Name | N'-(4-ethylphenyl)-N'-methyl-N-propylbutane-1,4-diamine |
|---|---|
| PubChem CID | 62434751 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | N'-(4-ethylphenyl)-N'-methyl-N-propylbutane-1,4-diamine |
| SMILES | CCCNCCCCN(C)c1ccc(CC)cc1 |
| InChI | InChI=1S/C16H28N2/c1-4-12-17-13-6-7-14-18(3)16-10-8-15(5-2)9-11-16/h8-11,17H,4-7,12-14H2,1-3H3 |
| InChIKey | OYJSSUPSCJNGEM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|