C17H28N2O — CID 62435033
N-cyclopropyl-N'-[(4-methoxyphenyl)methyl]-N'-methylpentane-1,5-diamine (PubChem CID 62435033) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is N-cyclopropyl-N'-[(4-methoxyphenyl)methyl]-N'-methylpentane-1,5-diamine.
| Compound Name | N-cyclopropyl-N'-[(4-methoxyphenyl)methyl]-N'-methylpentane-1,5-diamine |
|---|---|
| PubChem CID | 62435033 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | N-cyclopropyl-N'-[(4-methoxyphenyl)methyl]-N'-methylpentane-1,5-diamine |
| SMILES | COc1ccc(CN(C)CCCCCNC2CC2)cc1 |
| InChI | InChI=1S/C17H28N2O/c1-19(13-5-3-4-12-18-16-8-9-16)14-15-6-10-17(20-2)11-7-15/h6-7,10-11,16,18H,3-5,8-9,12-14H2,1-2H3 |
| InChIKey | OEZSGXHDNYFFOD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|