C16H34N2O — CID 62435981
N-(2-methylpropyl)-5-(2,2,6-trimethylmorpholin-4-yl)pentan-1-amine (PubChem CID 62435981) has the molecular formula C16H34N2O and a molecular weight of 270.46 g/mol. Its IUPAC name is N-(2-methylpropyl)-5-(2,2,6-trimethylmorpholin-4-yl)pentan-1-amine.
| Compound Name | N-(2-methylpropyl)-5-(2,2,6-trimethylmorpholin-4-yl)pentan-1-amine |
|---|---|
| PubChem CID | 62435981 |
| Molecular Formula | C16H34N2O |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.27 |
| IUPAC Name | N-(2-methylpropyl)-5-(2,2,6-trimethylmorpholin-4-yl)pentan-1-amine |
| SMILES | CC(C)CNCCCCCN1CC(C)OC(C)(C)C1 |
| InChI | InChI=1S/C16H34N2O/c1-14(2)11-17-9-7-6-8-10-18-12-15(3)19-16(4,5)13-18/h14-15,17H,6-13H2,1-5H3 |
| InChIKey | IJJBHTXWHWYFKA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|