C16H35N3O — CID 62436901
N,N-dimethyl-N'-propyl-N'-[[5-(propylaminomethyl)oxolan-2-yl]methyl]ethane-1,2-diamine (PubChem CID 62436901) has the molecular formula C16H35N3O and a molecular weight of 285.48 g/mol. Its IUPAC name is N,N-dimethyl-N'-propyl-N'-[[5-(propylaminomethyl)oxolan-2-yl]methyl]ethane-1,2-diamine.
| Compound Name | N,N-dimethyl-N'-propyl-N'-[[5-(propylaminomethyl)oxolan-2-yl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 62436901 |
| Molecular Formula | C16H35N3O |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.28 |
| IUPAC Name | N,N-dimethyl-N'-propyl-N'-[[5-(propylaminomethyl)oxolan-2-yl]methyl]ethane-1,2-diamine |
| SMILES | CCCNCC1CCC(CN(CCC)CCN(C)C)O1 |
| InChI | InChI=1S/C16H35N3O/c1-5-9-17-13-15-7-8-16(20-15)14-19(10-6-2)12-11-18(3)4/h15-17H,5-14H2,1-4H3 |
| InChIKey | CMMJECBNQCOHMR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|